C13H21BrN2O2 — CID 105270725
[1-(5-bromo-2-methoxyphenyl)-3-methoxypentan-2-yl]hydrazine (PubChem CID 105270725) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is [1-(5-bromo-2-methoxyphenyl)-3-methoxypentan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-2-methoxyphenyl)-3-methoxypentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105270725 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [1-(5-bromo-2-methoxyphenyl)-3-methoxypentan-2-yl]hydrazine |
| SMILES | CCC(OC)C(Cc1cc(Br)ccc1OC)NN |
| InChI | InChI=1S/C13H21BrN2O2/c1-4-12(17-2)11(16-15)8-9-7-10(14)5-6-13(9)18-3/h5-7,11-12,16H,4,8,15H2,1-3H3 |
| InChIKey | URCWNLBGTIWUQL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|