C12H19BrN2O2 — CID 105235318
[1-(5-bromo-2-methoxyphenyl)-3-ethoxypropan-2-yl]hydrazine (PubChem CID 105235318) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is [1-(5-bromo-2-methoxyphenyl)-3-ethoxypropan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-2-methoxyphenyl)-3-ethoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105235318 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [1-(5-bromo-2-methoxyphenyl)-3-ethoxypropan-2-yl]hydrazine |
| SMILES | CCOCC(Cc1cc(Br)ccc1OC)NN |
| InChI | InChI=1S/C12H19BrN2O2/c1-3-17-8-11(15-14)7-9-6-10(13)4-5-12(9)16-2/h4-6,11,15H,3,7-8,14H2,1-2H3 |
| InChIKey | XINMSZGVGRBMBZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|