C13H14BrClN2O2 — CID 106694227
[2-(5-bromo-2-methoxyphenyl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine (PubChem CID 106694227) has the molecular formula C13H14BrClN2O2 and a molecular weight of 345.62 g/mol. Its IUPAC name is [2-(5-bromo-2-methoxyphenyl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2-methoxyphenyl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106694227 |
| Molecular Formula | C13H14BrClN2O2 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | [2-(5-bromo-2-methoxyphenyl)-1-(5-chlorofuran-2-yl)ethyl]hydrazine |
| SMILES | COc1ccc(Br)cc1CC(NN)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H14BrClN2O2/c1-18-11-3-2-9(14)6-8(11)7-10(17-16)12-4-5-13(15)19-12/h2-6,10,17H,7,16H2,1H3 |
| InChIKey | NNBGXMPIOKSKDL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|