C15H15Br2ClN2O — CID 105290179
[1-(3-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethyl]hydrazine (PubChem CID 105290179) has the molecular formula C15H15Br2ClN2O and a molecular weight of 434.56 g/mol. Its IUPAC name is [1-(3-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105290179 |
| Molecular Formula | C15H15Br2ClN2O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | [1-(3-bromo-2-chlorophenyl)-2-(5-bromo-2-methoxyphenyl)ethyl]hydrazine |
| SMILES | COc1ccc(Br)cc1CC(NN)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C15H15Br2ClN2O/c1-21-14-6-5-10(16)7-9(14)8-13(20-19)11-3-2-4-12(17)15(11)18/h2-7,13,20H,8,19H2,1H3 |
| InChIKey | OOCQROYJRAZVRU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|