C15H17BrFN3O — CID 105263218
2-[2-(5-bromo-2-methoxyphenyl)-1-hydrazinylethyl]-4-fluoroaniline (PubChem CID 105263218) has the molecular formula C15H17BrFN3O and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)-1-hydrazinylethyl]-4-fluoroaniline.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)-1-hydrazinylethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 105263218 |
| Molecular Formula | C15H17BrFN3O |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)-1-hydrazinylethyl]-4-fluoroaniline |
| SMILES | COc1ccc(Br)cc1CC(NN)c1cc(F)ccc1N |
| InChI | InChI=1S/C15H17BrFN3O/c1-21-15-5-2-10(16)6-9(15)7-14(20-19)12-8-11(17)3-4-13(12)18/h2-6,8,14,20H,7,18-19H2,1H3 |
| InChIKey | RKXCEPGHXZMYIX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|