C15H17BrFN3 — CID 105377915
4-bromo-2-[2-(5-fluoro-2-methylphenyl)-1-hydrazinylethyl]aniline (PubChem CID 105377915) has the molecular formula C15H17BrFN3 and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-bromo-2-[2-(5-fluoro-2-methylphenyl)-1-hydrazinylethyl]aniline.
| Compound Name | 4-bromo-2-[2-(5-fluoro-2-methylphenyl)-1-hydrazinylethyl]aniline |
|---|---|
| PubChem CID | 105377915 |
| Molecular Formula | C15H17BrFN3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-bromo-2-[2-(5-fluoro-2-methylphenyl)-1-hydrazinylethyl]aniline |
| SMILES | Cc1ccc(F)cc1CC(NN)c1cc(Br)ccc1N |
| InChI | InChI=1S/C15H17BrFN3/c1-9-2-4-12(17)6-10(9)7-15(20-19)13-8-11(16)3-5-14(13)18/h2-6,8,15,20H,7,18-19H2,1H3 |
| InChIKey | KOVGWDLFXQQYLQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|