C15H14F4N2 — CID 105378026
[2-(5-fluoro-2-methylphenyl)-1-(2,3,4-trifluorophenyl)ethyl]hydrazine (PubChem CID 105378026) has the molecular formula C15H14F4N2 and a molecular weight of 298.28 g/mol. Its IUPAC name is [2-(5-fluoro-2-methylphenyl)-1-(2,3,4-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(5-fluoro-2-methylphenyl)-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105378026 |
| Molecular Formula | C15H14F4N2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-(5-fluoro-2-methylphenyl)-1-(2,3,4-trifluorophenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(F)cc1CC(NN)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H14F4N2/c1-8-2-3-10(16)6-9(8)7-13(21-20)11-4-5-12(17)15(19)14(11)18/h2-6,13,21H,7,20H2,1H3 |
| InChIKey | IDWNWYVMNNNQPI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|