C15H15BrF2N2 — CID 105291814
[1-(5-bromo-2-methylphenyl)-2-(2,4-difluorophenyl)ethyl]hydrazine (PubChem CID 105291814) has the molecular formula C15H15BrF2N2 and a molecular weight of 341.20 g/mol. Its IUPAC name is [1-(5-bromo-2-methylphenyl)-2-(2,4-difluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(5-bromo-2-methylphenyl)-2-(2,4-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105291814 |
| Molecular Formula | C15H15BrF2N2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [1-(5-bromo-2-methylphenyl)-2-(2,4-difluorophenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(Br)cc1C(Cc1ccc(F)cc1F)NN |
| InChI | InChI=1S/C15H15BrF2N2/c1-9-2-4-11(16)7-13(9)15(20-19)6-10-3-5-12(17)8-14(10)18/h2-5,7-8,15,20H,6,19H2,1H3 |
| InChIKey | BRAWOSNIFNVUPZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|