C16H18BrNO2 — CID 63367802
2-[2-[(1S)-1-aminoethyl]-4-bromophenoxy]-1-phenylethanol (PubChem CID 63367802) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[2-[(1S)-1-aminoethyl]-4-bromophenoxy]-1-phenylethanol.
| Compound Name | 2-[2-[(1S)-1-aminoethyl]-4-bromophenoxy]-1-phenylethanol |
|---|---|
| PubChem CID | 63367802 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[2-[(1S)-1-aminoethyl]-4-bromophenoxy]-1-phenylethanol |
| SMILES | C[C@H](N)c1cc(Br)ccc1OCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H18BrNO2/c1-11(18)14-9-13(17)7-8-16(14)20-10-15(19)12-5-3-2-4-6-12/h2-9,11,15,19H,10,18H2,1H3/t11-,15?/m0/s1 |
| InChIKey | SQPPRBMAYUXDKX-VPHXOMNUSA-N |
| XLogP | 3.58 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |