C15H24BrNO — CID 114200049
(1S)-1-[5-bromo-2-(2,4-dimethylpentoxy)phenyl]ethanamine (PubChem CID 114200049) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is (1S)-1-[5-bromo-2-(2,4-dimethylpentoxy)phenyl]ethanamine.
| Compound Name | (1S)-1-[5-bromo-2-(2,4-dimethylpentoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 114200049 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (1S)-1-[5-bromo-2-(2,4-dimethylpentoxy)phenyl]ethanamine |
| SMILES | CC(C)CC(C)COc1ccc(Br)cc1[C@H](C)N |
| InChI | InChI=1S/C15H24BrNO/c1-10(2)7-11(3)9-18-15-6-5-13(16)8-14(15)12(4)17/h5-6,8,10-12H,7,9,17H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | OCXYBQWKYASEBQ-KIYNQFGBSA-N |
| XLogP | 4.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |