C13H18N2O6 — CID 54127627
[2-[3-(2-carbamoyloxy-1-hydroxyethyl)-4-methylphenyl]-2-hydroxyethyl] carbamate (PubChem CID 54127627) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is [2-[3-(2-carbamoyloxy-1-hydroxyethyl)-4-methylphenyl]-2-hydroxyethyl] carbamate.
| Compound Name | [2-[3-(2-carbamoyloxy-1-hydroxyethyl)-4-methylphenyl]-2-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 54127627 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [2-[3-(2-carbamoyloxy-1-hydroxyethyl)-4-methylphenyl]-2-hydroxyethyl] carbamate |
| SMILES | Cc1ccc(C(O)COC(N)=O)cc1C(O)COC(N)=O |
| InChI | InChI=1S/C13H18N2O6/c1-7-2-3-8(10(16)5-20-12(14)18)4-9(7)11(17)6-21-13(15)19/h2-4,10-11,16-17H,5-6H2,1H3,(H2,14,18)(H2,15,19) |
| InChIKey | NSCJCJYPPBHABP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |