C11H17NO3 — CID 143824751
3-(4-aminophenyl)-2-ethoxypropane-1,1-diol (PubChem CID 143824751) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-ethoxypropane-1,1-diol.
| Compound Name | 3-(4-aminophenyl)-2-ethoxypropane-1,1-diol |
|---|---|
| PubChem CID | 143824751 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-(4-aminophenyl)-2-ethoxypropane-1,1-diol |
| SMILES | CCOC(Cc1ccc(N)cc1)C(O)O |
| InChI | InChI=1S/C11H17NO3/c1-2-15-10(11(13)14)7-8-3-5-9(12)6-4-8/h3-6,10-11,13-14H,2,7,12H2,1H3 |
| InChIKey | CHZMDSWNJAIAHT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|