C9H13NO2 — CID 130130867
3-(4-aminophenyl)propane-1,2-diol (PubChem CID 130130867) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(4-aminophenyl)propane-1,2-diol.
| Compound Name | 3-(4-aminophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 130130867 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-(4-aminophenyl)propane-1,2-diol |
| SMILES | Nc1ccc(CC(O)CO)cc1 |
| InChI | InChI=1S/C9H13NO2/c10-8-3-1-7(2-4-8)5-9(12)6-11/h1-4,9,11-12H,5-6,10H2 |
| InChIKey | VDJVQLQDQCMILX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|