C18H30O2 — CID 116713429
3-ethoxy-4,4-dimethyl-1-(4-propan-2-ylphenyl)pentan-2-ol (PubChem CID 116713429) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-ethoxy-4,4-dimethyl-1-(4-propan-2-ylphenyl)pentan-2-ol.
| Compound Name | 3-ethoxy-4,4-dimethyl-1-(4-propan-2-ylphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 116713429 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3-ethoxy-4,4-dimethyl-1-(4-propan-2-ylphenyl)pentan-2-ol |
| SMILES | CCOC(C(O)Cc1ccc(C(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H30O2/c1-7-20-17(18(4,5)6)16(19)12-14-8-10-15(11-9-14)13(2)3/h8-11,13,16-17,19H,7,12H2,1-6H3 |
| InChIKey | YESWHHCOTWCOHO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |