C16H26O3 — CID 116713469
3-ethoxy-1-(2-methoxyphenyl)-4,4-dimethylpentan-2-ol (PubChem CID 116713469) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-ethoxy-1-(2-methoxyphenyl)-4,4-dimethylpentan-2-ol.
| Compound Name | 3-ethoxy-1-(2-methoxyphenyl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 116713469 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3-ethoxy-1-(2-methoxyphenyl)-4,4-dimethylpentan-2-ol |
| SMILES | CCOC(C(O)Cc1ccccc1OC)C(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-6-19-15(16(2,3)4)13(17)11-12-9-7-8-10-14(12)18-5/h7-10,13,15,17H,6,11H2,1-5H3 |
| InChIKey | HUBXJSOXOPNMFO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |