C20H24N2O5 — CID 70241702
(3S,5R)-3-hydroxy-2,5-bis(phenylmethoxy)hexanediamide (PubChem CID 70241702) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3S,5R)-3-hydroxy-2,5-bis(phenylmethoxy)hexanediamide.
| Compound Name | (3S,5R)-3-hydroxy-2,5-bis(phenylmethoxy)hexanediamide |
|---|---|
| PubChem CID | 70241702 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3S,5R)-3-hydroxy-2,5-bis(phenylmethoxy)hexanediamide |
| SMILES | NC(=O)C(OCc1ccccc1)[C@@H](O)C[C@@H](OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C20H24N2O5/c21-19(24)17(26-12-14-7-3-1-4-8-14)11-16(23)18(20(22)25)27-13-15-9-5-2-6-10-15/h1-10,16-18,23H,11-13H2,(H2,21,24)(H2,22,25)/t16-,17+,18?/m0/s1 |
| InChIKey | JXEUCNUYHMNUBH-MYFVLZFPSA-N |
| XLogP | 0.88 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |