C17H22O3S — CID 151273410
1-[(4-thiophen-2-ylphenyl)methoxy]hexane-3,4-diol (PubChem CID 151273410) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-[(4-thiophen-2-ylphenyl)methoxy]hexane-3,4-diol.
| Compound Name | 1-[(4-thiophen-2-ylphenyl)methoxy]hexane-3,4-diol |
|---|---|
| PubChem CID | 151273410 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[(4-thiophen-2-ylphenyl)methoxy]hexane-3,4-diol |
| SMILES | CCC(O)C(O)CCOCc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-2-15(18)16(19)9-10-20-12-13-5-7-14(8-6-13)17-4-3-11-21-17/h3-8,11,15-16,18-19H,2,9-10,12H2,1H3 |
| InChIKey | NWVSTVWESBNKFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|