C16H20N4O2S — CID 69142316
1-[[(2R)-2-aminobutanoyl]amino]-3-[(4-thiophen-2-ylphenyl)methyl]urea (PubChem CID 69142316) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[[(2R)-2-aminobutanoyl]amino]-3-[(4-thiophen-2-ylphenyl)methyl]urea.
| Compound Name | 1-[[(2R)-2-aminobutanoyl]amino]-3-[(4-thiophen-2-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 69142316 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[[(2R)-2-aminobutanoyl]amino]-3-[(4-thiophen-2-ylphenyl)methyl]urea |
| SMILES | CC[C@@H](N)C(=O)NNC(=O)NCc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-13(17)15(21)19-20-16(22)18-10-11-5-7-12(8-6-11)14-4-3-9-23-14/h3-9,13H,2,10,17H2,1H3,(H,19,21)(H2,18,20,22)/t13-/m1/s1 |
| InChIKey | NQFMJCOVLGASHO-CYBMUJFWSA-N |
| XLogP | 1.98 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|