C26H31N3O3 — CID 18338631
1-benzyl-N-cyclohexyl-3,6-dioxo-5-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 18338631) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-benzyl-N-cyclohexyl-3,6-dioxo-5-(2-phenylethyl)piperazine-2-carboxamide.
| Compound Name | 1-benzyl-N-cyclohexyl-3,6-dioxo-5-(2-phenylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 18338631 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 1-benzyl-N-cyclohexyl-3,6-dioxo-5-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1C(=O)NC(CCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H31N3O3/c30-24(27-21-14-8-3-9-15-21)23-25(31)28-22(17-16-19-10-4-1-5-11-19)26(32)29(23)18-20-12-6-2-7-13-20/h1-2,4-7,10-13,21-23H,3,8-9,14-18H2,(H,27,30)(H,28,31) |
| InChIKey | GRPLWBQSOJLJIY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|