C22H38N6O3 — CID 18338837
N-cyclohexyl-1-(cyclohexylmethyl)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide (PubChem CID 18338837) has the molecular formula C22H38N6O3 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-cyclohexyl-1-(cyclohexylmethyl)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide.
| Compound Name | N-cyclohexyl-1-(cyclohexylmethyl)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18338837 |
| Molecular Formula | C22H38N6O3 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | N-cyclohexyl-1-(cyclohexylmethyl)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide |
| SMILES | NC(N)=NCCCC1NC(=O)C(C(=O)NC2CCCCC2)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C22H38N6O3/c23-22(24)25-13-7-12-17-21(31)28(14-15-8-3-1-4-9-15)18(20(30)27-17)19(29)26-16-10-5-2-6-11-16/h15-18H,1-14H2,(H,26,29)(H,27,30)(H4,23,24,25) |
| InChIKey | BDCAUTOEFBAQFJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|