C29H29N3O2 — CID 25257301
4-benzyl-N-cyclohexyl-5-oxo-2-phenyl-3H-1,4-benzodiazepine-3-carboxamide (PubChem CID 25257301) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 4-benzyl-N-cyclohexyl-5-oxo-2-phenyl-3H-1,4-benzodiazepine-3-carboxamide.
| Compound Name | 4-benzyl-N-cyclohexyl-5-oxo-2-phenyl-3H-1,4-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 25257301 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 4-benzyl-N-cyclohexyl-5-oxo-2-phenyl-3H-1,4-benzodiazepine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1C(c2ccccc2)=Nc2ccccc2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C29H29N3O2/c33-28(30-23-16-8-3-9-17-23)27-26(22-14-6-2-7-15-22)31-25-19-11-10-18-24(25)29(34)32(27)20-21-12-4-1-5-13-21/h1-2,4-7,10-15,18-19,23,27H,3,8-9,16-17,20H2,(H,30,33) |
| InChIKey | JKRMBMQBSJCTBP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |