About N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide
N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide (PubChem CID 110855496) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide |
| PubChem CID | 110855496 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H24N2O2/c1-11-10-12(2)18(3)16(20)14(11)15(19)17-13-8-6-4-5-7-9-13/h10,13H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | WJOKPBUYSARDSV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide?
The IUPAC name of N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide (CID 110855496) is N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide.
What is the SMILES notation for N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide?
The canonical SMILES for N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide is Cc1cc(C)n(C)c(=O)c1C(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide?
The InChIKey is WJOKPBUYSARDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-11-10-12(2)18(3)16(20)14(11)15(19)17-13-8-6-4-5-7-9-13/h10,13H,4-9H2,1-3H3,(H,17,19).
What are the key properties of N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide?
N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide has a molecular weight of 276.38 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-1,4,6-trimethyl-2-oxopyridine-3-carboxamide is sourced from PubChem (CID 110855496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).