C13H19N3O2 — CID 136911212
N-cyclohexyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136911212) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-cyclohexyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136911212 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-cyclohexyl-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H19N3O2/c1-8-11(12(17)15-9(2)14-8)13(18)16-10-6-4-3-5-7-10/h10H,3-7H2,1-2H3,(H,16,18)(H,14,15,17) |
| InChIKey | IHNWCOJOOXSZGQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |