C8H9N3O3S — CID 3728354
N-cyclopropyl-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide (PubChem CID 3728354) has the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. Its IUPAC name is N-cyclopropyl-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide.
| Compound Name | N-cyclopropyl-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3728354 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | N-cyclopropyl-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CC1)c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C8H9N3O3S/c12-5(9-3-1-2-3)4-6(13)10-8(15)11-7(4)14/h3H,1-2H2,(H,9,12)(H3,10,11,13,14,15) |
| InChIKey | DHSICKBMNGDWFI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|