C11H8FN3O4S — CID 118310840
N-(2-fluoro-4-hydroxyphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide (PubChem CID 118310840) has the molecular formula C11H8FN3O4S and a molecular weight of 297.27 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxyphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-fluoro-4-hydroxyphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118310840 |
| Molecular Formula | C11H8FN3O4S |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-(2-fluoro-4-hydroxyphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1F)c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C11H8FN3O4S/c12-5-3-4(16)1-2-6(5)13-8(17)7-9(18)14-11(20)15-10(7)19/h1-3,16H,(H,13,17)(H3,14,15,18,19,20) |
| InChIKey | KZVBTEIICSXQGU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|