C13H11F2N3OS — CID 67840861
N-(2,4-difluorophenyl)-2,6-dimethyl-4-sulfanylidene-1H-pyrimidine-5-carboxamide (PubChem CID 67840861) has the molecular formula C13H11F2N3OS and a molecular weight of 295.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,6-dimethyl-4-sulfanylidene-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2,6-dimethyl-4-sulfanylidene-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67840861 |
| Molecular Formula | C13H11F2N3OS |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,6-dimethyl-4-sulfanylidene-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(=S)c(C(=O)Nc2ccc(F)cc2F)c(C)[nH]1 |
| InChI | InChI=1S/C13H11F2N3OS/c1-6-11(13(20)17-7(2)16-6)12(19)18-10-4-3-8(14)5-9(10)15/h3-5H,1-2H3,(H,18,19)(H,16,17,20) |
| InChIKey | NAEHLQIIFVQUQS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|