C9H11Br2N3O — CID 19508390
4,5-dibromo-N-cyclopentyl-1H-pyrazole-3-carboxamide (PubChem CID 19508390) has the molecular formula C9H11Br2N3O and a molecular weight of 337.02 g/mol. Its IUPAC name is 4,5-dibromo-N-cyclopentyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4,5-dibromo-N-cyclopentyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508390 |
| Molecular Formula | C9H11Br2N3O |
| Molecular Weight | 337.02 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 4,5-dibromo-N-cyclopentyl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1n[nH]c(Br)c1Br |
| InChI | InChI=1S/C9H11Br2N3O/c10-6-7(13-14-8(6)11)9(15)12-5-3-1-2-4-5/h5H,1-4H2,(H,12,15)(H,13,14) |
| InChIKey | ODSCOFPLOWISCE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.02 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |