C9H11N3O3S — CID 117214899
4-(cyclopentylcarbamoyl)thiadiazole-5-carboxylic acid (PubChem CID 117214899) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-(cyclopentylcarbamoyl)thiadiazole-5-carboxylic acid.
| Compound Name | 4-(cyclopentylcarbamoyl)thiadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117214899 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-(cyclopentylcarbamoyl)thiadiazole-5-carboxylic acid |
| SMILES | O=C(NC1CCCC1)c1nnsc1C(=O)O |
| InChI | InChI=1S/C9H11N3O3S/c13-8(10-5-3-1-2-4-5)6-7(9(14)15)16-12-11-6/h5H,1-4H2,(H,10,13)(H,14,15) |
| InChIKey | WRSCLAXMDURFMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |