C20H26N6O2S — CID 17037036
N-cyclohexyl-5-[(4-phenylpiperazine-1-carbonyl)amino]thiadiazole-4-carboxamide (PubChem CID 17037036) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is N-cyclohexyl-5-[(4-phenylpiperazine-1-carbonyl)amino]thiadiazole-4-carboxamide.
| Compound Name | N-cyclohexyl-5-[(4-phenylpiperazine-1-carbonyl)amino]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 17037036 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-cyclohexyl-5-[(4-phenylpiperazine-1-carbonyl)amino]thiadiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1nnsc1NC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N6O2S/c27-18(21-15-7-3-1-4-8-15)17-19(29-24-23-17)22-20(28)26-13-11-25(12-14-26)16-9-5-2-6-10-16/h2,5-6,9-10,15H,1,3-4,7-8,11-14H2,(H,21,27)(H,22,28) |
| InChIKey | RUFCFRYQHHQYRE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |