C14H14ClN5O3S — CID 6917313
5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]thiadiazole-4-carboxylic acid (PubChem CID 6917313) has the molecular formula C14H14ClN5O3S and a molecular weight of 367.82 g/mol. Its IUPAC name is 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]thiadiazole-4-carboxylic acid.
| Compound Name | 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]thiadiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 6917313 |
| Molecular Formula | C14H14ClN5O3S |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]thiadiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnsc1NC(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H14ClN5O3S/c15-9-2-1-3-10(8-9)19-4-6-20(7-5-19)14(23)16-12-11(13(21)22)17-18-24-12/h1-3,8H,4-7H2,(H,16,23)(H,21,22) |
| InChIKey | LUPUUBLLBPVNOE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |