C13H19N5OS — CID 65205676
N-[1-(cyanomethyl)piperidin-4-yl]-4-propylthiadiazole-5-carboxamide (PubChem CID 65205676) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is N-[1-(cyanomethyl)piperidin-4-yl]-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[1-(cyanomethyl)piperidin-4-yl]-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65205676 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[1-(cyanomethyl)piperidin-4-yl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NC1CCN(CC#N)CC1 |
| InChI | InChI=1S/C13H19N5OS/c1-2-3-11-12(20-17-16-11)13(19)15-10-4-7-18(8-5-10)9-6-14/h10H,2-5,7-9H2,1H3,(H,15,19) |
| InChIKey | WZTSZFTVAXUIBE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|