C11H14N4OS — CID 113233064
N-[1-(cyanomethyl)piperidin-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 113233064) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is N-[1-(cyanomethyl)piperidin-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-(cyanomethyl)piperidin-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 113233064 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-[1-(cyanomethyl)piperidin-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | N#CCN1CCC(NC(=O)c2cncs2)CC1 |
| InChI | InChI=1S/C11H14N4OS/c12-3-6-15-4-1-9(2-5-15)14-11(16)10-7-13-8-17-10/h7-9H,1-2,4-6H2,(H,14,16) |
| InChIKey | LKWWZMVFXGCPGF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|