C13H13N3OS — CID 155963732
2-amino-N-cyclopropyl-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 155963732) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-cyclopropyl-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155963732 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-amino-N-cyclopropyl-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)NC2CC2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H13N3OS/c14-13-16-10(12(17)15-9-6-7-9)11(18-13)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,14,16)(H,15,17) |
| InChIKey | DSXKPDYSGPHURD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |