C20H19N3OS — CID 110867733
N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-3-phenylbenzamide (PubChem CID 110867733) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-3-phenylbenzamide.
| Compound Name | N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-3-phenylbenzamide |
|---|---|
| PubChem CID | 110867733 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-3-phenylbenzamide |
| SMILES | Nc1nc2c(s1)CC(NC(=O)c1cccc(-c3ccccc3)c1)CC2 |
| InChI | InChI=1S/C20H19N3OS/c21-20-23-17-10-9-16(12-18(17)25-20)22-19(24)15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-8,11,16H,9-10,12H2,(H2,21,23)(H,22,24) |
| InChIKey | FSTDLDFDCFYGKQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |