C9H14N4 — CID 142425715
ethane;2-(ethylamino)pyrimidine-5-carbonitrile (PubChem CID 142425715) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is ethane;2-(ethylamino)pyrimidine-5-carbonitrile.
| Compound Name | ethane;2-(ethylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 142425715 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | ethane;2-(ethylamino)pyrimidine-5-carbonitrile |
| SMILES | CC.CCNc1ncc(C#N)cn1 |
| InChI | InChI=1S/C7H8N4.C2H6/c1-2-9-7-10-4-6(3-8)5-11-7;1-2/h4-5H,2H2,1H3,(H,9,10,11);1-2H3 |
| InChIKey | UGBUXFKFLWETQY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |