C8H9N5 — CID 140978165
N-ethylpyrimido[5,4-d]pyrimidin-2-amine (PubChem CID 140978165) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is N-ethylpyrimido[5,4-d]pyrimidin-2-amine.
| Compound Name | N-ethylpyrimido[5,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 140978165 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-ethylpyrimido[5,4-d]pyrimidin-2-amine |
| SMILES | CCNc1ncc2ncncc2n1 |
| InChI | InChI=1S/C8H9N5/c1-2-10-8-11-4-6-7(13-8)3-9-5-12-6/h3-5H,2H2,1H3,(H,10,11,13) |
| InChIKey | ZTBOGQYNWALXIP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |