C9H16N4 — CID 102536247
N-ethyl-5-(ethylaminomethyl)pyrimidin-2-amine (PubChem CID 102536247) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-ethyl-5-(ethylaminomethyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-(ethylaminomethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 102536247 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-ethyl-5-(ethylaminomethyl)pyrimidin-2-amine |
| SMILES | CCNCc1cnc(NCC)nc1 |
| InChI | InChI=1S/C9H16N4/c1-3-10-5-8-6-12-9(11-4-2)13-7-8/h6-7,10H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | KPPVQIDAFOLGFZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |