C12H20N4O2S — CID 102536302
2-[[2-(ethylamino)pyrimidin-5-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 102536302) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-[[2-(ethylamino)pyrimidin-5-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(ethylamino)pyrimidin-5-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 102536302 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[[2-(ethylamino)pyrimidin-5-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCNc1ncc(CNC(CCSC)C(=O)O)cn1 |
| InChI | InChI=1S/C12H20N4O2S/c1-3-13-12-15-7-9(8-16-12)6-14-10(11(17)18)4-5-19-2/h7-8,10,14H,3-6H2,1-2H3,(H,17,18)(H,13,15,16) |
| InChIKey | HDUFRNBGKPXAOG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |