C20H26N2O2S — CID 102563028
2-[[4-(N-ethylanilino)phenyl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 102563028) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 2-[[4-(N-ethylanilino)phenyl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-(N-ethylanilino)phenyl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 102563028 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[[4-(N-ethylanilino)phenyl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCN(c1ccccc1)c1ccc(CNC(CCSC)C(=O)O)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-3-22(17-7-5-4-6-8-17)18-11-9-16(10-12-18)15-21-19(20(23)24)13-14-25-2/h4-12,19,21H,3,13-15H2,1-2H3,(H,23,24) |
| InChIKey | SIVFXGSZPCCHAP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |