C20H25NO3S — CID 66527996
2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 66527996) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 66527996 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[[2-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NCc1ccccc1OCc1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C20H25NO3S/c1-15-7-9-16(10-8-15)14-24-19-6-4-3-5-17(19)13-21-18(20(22)23)11-12-25-2/h3-10,18,21H,11-14H2,1-2H3,(H,22,23) |
| InChIKey | FLDDMXMYLVWYOC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |