C19H22ClNO3S — CID 66527388
2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 66527388) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 66527388 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NCc1ccccc1OCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H22ClNO3S/c1-25-11-10-17(19(22)23)21-12-15-4-2-3-5-18(15)24-13-14-6-8-16(20)9-7-14/h2-9,17,21H,10-13H2,1H3,(H,22,23) |
| InChIKey | PLKJFFPEZGUWAL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |