C22H29NO4S — CID 66528192
2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 66528192) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 66528192 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCOc1cc(CNC(CCSC)C(=O)O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C22H29NO4S/c1-4-26-21-13-17(14-23-19(22(24)25)11-12-28-3)9-10-20(21)27-15-18-8-6-5-7-16(18)2/h5-10,13,19,23H,4,11-12,14-15H2,1-3H3,(H,24,25) |
| InChIKey | NSTPMBSUWHWIIY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |