C20H25NO4 — CID 66528181
2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]propanoic acid (PubChem CID 66528181) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]propanoic acid.
| Compound Name | 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66528181 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-[[3-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]propanoic acid |
| SMILES | CCOc1cc(CNC(C)C(=O)O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C20H25NO4/c1-4-24-19-11-16(12-21-15(3)20(22)23)9-10-18(19)25-13-17-8-6-5-7-14(17)2/h5-11,15,21H,4,12-13H2,1-3H3,(H,22,23) |
| InChIKey | GPAYNIDXASIBFV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |