C10H16N4O2 — CID 102536297
3-[[2-(ethylamino)pyrimidin-5-yl]methylamino]propanoic acid (PubChem CID 102536297) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[[2-(ethylamino)pyrimidin-5-yl]methylamino]propanoic acid.
| Compound Name | 3-[[2-(ethylamino)pyrimidin-5-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 102536297 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-[[2-(ethylamino)pyrimidin-5-yl]methylamino]propanoic acid |
| SMILES | CCNc1ncc(CNCCC(=O)O)cn1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-12-10-13-6-8(7-14-10)5-11-4-3-9(15)16/h6-7,11H,2-5H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | VDOUYQDEMRTBHU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|