C11H17N3O2S — CID 102536092
4-[(2-ethylsulfanylpyrimidin-5-yl)methylamino]butanoic acid (PubChem CID 102536092) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-[(2-ethylsulfanylpyrimidin-5-yl)methylamino]butanoic acid.
| Compound Name | 4-[(2-ethylsulfanylpyrimidin-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 102536092 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-[(2-ethylsulfanylpyrimidin-5-yl)methylamino]butanoic acid |
| SMILES | CCSc1ncc(CNCCCC(=O)O)cn1 |
| InChI | InChI=1S/C11H17N3O2S/c1-2-17-11-13-7-9(8-14-11)6-12-5-3-4-10(15)16/h7-8,12H,2-6H2,1H3,(H,15,16) |
| InChIKey | FBSQOWWILREDGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|