C15H19FN4 — CID 102536258
N-ethyl-5-[[2-(4-fluorophenyl)ethylamino]methyl]pyrimidin-2-amine (PubChem CID 102536258) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is N-ethyl-5-[[2-(4-fluorophenyl)ethylamino]methyl]pyrimidin-2-amine.
| Compound Name | N-ethyl-5-[[2-(4-fluorophenyl)ethylamino]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102536258 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-ethyl-5-[[2-(4-fluorophenyl)ethylamino]methyl]pyrimidin-2-amine |
| SMILES | CCNc1ncc(CNCCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C15H19FN4/c1-2-18-15-19-10-13(11-20-15)9-17-8-7-12-3-5-14(16)6-4-12/h3-6,10-11,17H,2,7-9H2,1H3,(H,18,19,20) |
| InChIKey | WHPPHLHAIHOOJD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|