C15H15Cl3FN — CID 11958378
N-[(3,4-dichlorophenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride (PubChem CID 11958378) has the molecular formula C15H15Cl3FN and a molecular weight of 334.65 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 11958378 |
| Molecular Formula | C15H15Cl3FN |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.Fc1ccc(CCNCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2FN.ClH/c16-14-6-3-12(9-15(14)17)10-19-8-7-11-1-4-13(18)5-2-11;/h1-6,9,19H,7-8,10H2;1H |
| InChIKey | OQKDCAALXATSOM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|