C14H26N4O — CID 102536280
5-[(3-butoxypropylamino)methyl]-N-ethylpyrimidin-2-amine (PubChem CID 102536280) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-[(3-butoxypropylamino)methyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[(3-butoxypropylamino)methyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 102536280 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 5-[(3-butoxypropylamino)methyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCCCOCCCNCc1cnc(NCC)nc1 |
| InChI | InChI=1S/C14H26N4O/c1-3-5-8-19-9-6-7-15-10-13-11-17-14(16-4-2)18-12-13/h11-12,15H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | NMEVHQZAJJPNBS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|