C16H30N4 — CID 102536334
5-[(octylamino)methyl]-N-propan-2-ylpyrimidin-2-amine (PubChem CID 102536334) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-[(octylamino)methyl]-N-propan-2-ylpyrimidin-2-amine.
| Compound Name | 5-[(octylamino)methyl]-N-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 102536334 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 5-[(octylamino)methyl]-N-propan-2-ylpyrimidin-2-amine |
| SMILES | CCCCCCCCNCc1cnc(NC(C)C)nc1 |
| InChI | InChI=1S/C16H30N4/c1-4-5-6-7-8-9-10-17-11-15-12-18-16(19-13-15)20-14(2)3/h12-14,17H,4-11H2,1-3H3,(H,18,19,20) |
| InChIKey | YAJRPLFQQCKJID-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|