C14H19N5 — CID 102536345
N-propan-2-yl-5-[(pyridin-4-ylmethylamino)methyl]pyrimidin-2-amine (PubChem CID 102536345) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-propan-2-yl-5-[(pyridin-4-ylmethylamino)methyl]pyrimidin-2-amine.
| Compound Name | N-propan-2-yl-5-[(pyridin-4-ylmethylamino)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102536345 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-propan-2-yl-5-[(pyridin-4-ylmethylamino)methyl]pyrimidin-2-amine |
| SMILES | CC(C)Nc1ncc(CNCc2ccncc2)cn1 |
| InChI | InChI=1S/C14H19N5/c1-11(2)19-14-17-9-13(10-18-14)8-16-7-12-3-5-15-6-4-12/h3-6,9-11,16H,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | NTEIBBVIRNDYGV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |